C18H19NO5 — CID 110767410
2-(1,3-benzodioxol-5-yl)-N-[2-(4-methoxyphenoxy)ethyl]acetamide (PubChem CID 110767410) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[2-(4-methoxyphenoxy)ethyl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[2-(4-methoxyphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 110767410 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[2-(4-methoxyphenoxy)ethyl]acetamide |
| SMILES | COc1ccc(OCCNC(=O)Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H19NO5/c1-21-14-3-5-15(6-4-14)22-9-8-19-18(20)11-13-2-7-16-17(10-13)24-12-23-16/h2-7,10H,8-9,11-12H2,1H3,(H,19,20) |
| InChIKey | JYJHJXTUPGUMKM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|