C20H23NO4 — CID 110627843
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-(4-methoxyphenyl)propyl]acetamide (PubChem CID 110627843) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-(4-methoxyphenyl)propyl]acetamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-(4-methoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 110627843 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-(4-methoxyphenyl)propyl]acetamide |
| SMILES | COc1ccc(CCCNC(=O)Cc2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-23-17-7-4-15(5-8-17)3-2-10-21-20(22)14-16-6-9-18-19(13-16)25-12-11-24-18/h4-9,13H,2-3,10-12,14H2,1H3,(H,21,22) |
| InChIKey | MAOBLBUAHYRFPL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|