C21H27NO4 — CID 110288813
2-(3,4-dimethoxyphenyl)-N-[4-(4-methoxyphenyl)butyl]acetamide (PubChem CID 110288813) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[4-(4-methoxyphenyl)butyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[4-(4-methoxyphenyl)butyl]acetamide |
|---|---|
| PubChem CID | 110288813 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[4-(4-methoxyphenyl)butyl]acetamide |
| SMILES | COc1ccc(CCCCNC(=O)Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H27NO4/c1-24-18-10-7-16(8-11-18)6-4-5-13-22-21(23)15-17-9-12-19(25-2)20(14-17)26-3/h7-12,14H,4-6,13,15H2,1-3H3,(H,22,23) |
| InChIKey | SRSQPELWCMMAPM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|