C20H26N2O4 — CID 51290944
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]urea (PubChem CID 51290944) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]urea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 51290944 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(CCNC(=O)NCCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H26N2O4/c1-24-17-7-4-15(5-8-17)10-12-21-20(23)22-13-11-16-6-9-18(25-2)19(14-16)26-3/h4-9,14H,10-13H2,1-3H3,(H2,21,22,23) |
| InChIKey | QQJZQXIYADXDQM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |