C11H14INO3 — CID 163923195
N-[2-(3,4-dimethoxyphenyl)ethyl]carbamoyl iodide (PubChem CID 163923195) has the molecular formula C11H14INO3 and a molecular weight of 335.14 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]carbamoyl iodide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]carbamoyl iodide |
|---|---|
| PubChem CID | 163923195 |
| Molecular Formula | C11H14INO3 |
| Molecular Weight | 335.14 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]carbamoyl iodide |
| SMILES | COc1ccc(CCNC(=O)I)cc1OC |
| InChI | InChI=1S/C11H14INO3/c1-15-9-4-3-8(7-10(9)16-2)5-6-13-11(12)14/h3-4,7H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | RCFFZDDXSQYKAB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.14 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|