C16H23N3O5 — CID 108506297
N'-(2-acetamidoethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide (PubChem CID 108506297) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is N'-(2-acetamidoethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide.
| Compound Name | N'-(2-acetamidoethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108506297 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | N'-(2-acetamidoethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)NCCNC(C)=O)cc1OC |
| InChI | InChI=1S/C16H23N3O5/c1-11(20)17-8-9-19-16(22)15(21)18-7-6-12-4-5-13(23-2)14(10-12)24-3/h4-5,10H,6-9H2,1-3H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | BBVQNHIFILYFHP-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|