C20H24N2O6 — CID 2274190
N'-(2,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide (PubChem CID 2274190) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is N'-(2,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide.
| Compound Name | N'-(2,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 2274190 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N'-(2,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCCc2ccc(OC)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C20H24N2O6/c1-25-14-6-7-15(17(12-14)27-3)22-20(24)19(23)21-10-9-13-5-8-16(26-2)18(11-13)28-4/h5-8,11-12H,9-10H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | NCYRSYMQFHXWOJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|