C19H21N3O5 — CID 108506282
N'-(2-carbamoylphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide (PubChem CID 108506282) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is N'-(2-carbamoylphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide.
| Compound Name | N'-(2-carbamoylphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108506282 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N'-(2-carbamoylphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)Nc2ccccc2C(N)=O)cc1OC |
| InChI | InChI=1S/C19H21N3O5/c1-26-15-8-7-12(11-16(15)27-2)9-10-21-18(24)19(25)22-14-6-4-3-5-13(14)17(20)23/h3-8,11H,9-10H2,1-2H3,(H2,20,23)(H,21,24)(H,22,25) |
| InChIKey | BABBGIKBZXPDTH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|