C20H24N2O5 — CID 13352291
ethyl 2-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]benzoate (PubChem CID 13352291) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is ethyl 2-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]benzoate.
| Compound Name | ethyl 2-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 13352291 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | ethyl 2-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H24N2O5/c1-4-27-19(23)15-7-5-6-8-16(15)22-20(24)21-12-11-14-9-10-17(25-2)18(13-14)26-3/h5-10,13H,4,11-12H2,1-3H3,(H2,21,22,24) |
| InChIKey | DLVZIFFBOKXTCG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |