C18H21NO6 — CID 13206091
ethyl 4-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]furan-3-carboxylate (PubChem CID 13206091) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is ethyl 4-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]furan-3-carboxylate.
| Compound Name | ethyl 4-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 13206091 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | ethyl 4-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1cocc1C(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H21NO6/c1-4-25-18(21)14-11-24-10-13(14)17(20)19-8-7-12-5-6-15(22-2)16(9-12)23-3/h5-6,9-11H,4,7-8H2,1-3H3,(H,19,20) |
| InChIKey | JSYSRSOZQBSXIW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |