C18H22N2O3 — CID 110451906
2-(aminomethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide (PubChem CID 110451906) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide.
| Compound Name | 2-(aminomethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 110451906 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-(aminomethyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccccc2CN)cc1OC |
| InChI | InChI=1S/C18H22N2O3/c1-22-16-8-7-13(11-17(16)23-2)9-10-20-18(21)15-6-4-3-5-14(15)12-19/h3-8,11H,9-10,12,19H2,1-2H3,(H,20,21) |
| InChIKey | ZSHYGSYTBXHZNK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |