C20H24N2O5 — CID 108540073
N-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]-2-hydroxybenzamide (PubChem CID 108540073) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is N-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]-2-hydroxybenzamide.
| Compound Name | N-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 108540073 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]-2-hydroxybenzamide |
| SMILES | COc1ccc(CCC(=O)NCCNC(=O)c2ccccc2O)cc1OC |
| InChI | InChI=1S/C20H24N2O5/c1-26-17-9-7-14(13-18(17)27-2)8-10-19(24)21-11-12-22-20(25)15-5-3-4-6-16(15)23/h3-7,9,13,23H,8,10-12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | VBFDVSUEHNMEFO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|