C20H23BrN2O4 — CID 108539137
2-bromo-N-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]benzamide (PubChem CID 108539137) has the molecular formula C20H23BrN2O4 and a molecular weight of 435.32 g/mol. Its IUPAC name is 2-bromo-N-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]benzamide.
| Compound Name | 2-bromo-N-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 108539137 |
| Molecular Formula | C20H23BrN2O4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2-bromo-N-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]benzamide |
| SMILES | COc1ccc(CCC(=O)NCCNC(=O)c2ccccc2Br)cc1OC |
| InChI | InChI=1S/C20H23BrN2O4/c1-26-17-9-7-14(13-18(17)27-2)8-10-19(24)22-11-12-23-20(25)15-5-3-4-6-16(15)21/h3-7,9,13H,8,10-12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | JABSYDYXYUEQBB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|