C20H24N2O7 — CID 108540155
N-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]-3,4,5-trihydroxybenzamide (PubChem CID 108540155) has the molecular formula C20H24N2O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is N-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 108540155 |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]-3,4,5-trihydroxybenzamide |
| SMILES | COc1ccc(CCC(=O)NCCNC(=O)c2cc(O)c(O)c(O)c2)cc1OC |
| InChI | InChI=1S/C20H24N2O7/c1-28-16-5-3-12(9-17(16)29-2)4-6-18(25)21-7-8-22-20(27)13-10-14(23)19(26)15(24)11-13/h3,5,9-11,23-24,26H,4,6-8H2,1-2H3,(H,21,25)(H,22,27) |
| InChIKey | HCIPWKHRACYHIL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|