C22H21NO4S — CID 9404427
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(thiophene-2-carbonyl)benzamide (PubChem CID 9404427) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(thiophene-2-carbonyl)benzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(thiophene-2-carbonyl)benzamide |
|---|---|
| PubChem CID | 9404427 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(thiophene-2-carbonyl)benzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccccc2C(=O)c2cccs2)cc1OC |
| InChI | InChI=1S/C22H21NO4S/c1-26-18-10-9-15(14-19(18)27-2)11-12-23-22(25)17-7-4-3-6-16(17)21(24)20-8-5-13-28-20/h3-10,13-14H,11-12H2,1-2H3,(H,23,25) |
| InChIKey | BSEYCSYBAFKLTJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |