C19H26N2O4S — CID 90757175
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methoxyimino-2-thiophen-2-ylacetamide;ethane (PubChem CID 90757175) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methoxyimino-2-thiophen-2-ylacetamide;ethane.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methoxyimino-2-thiophen-2-ylacetamide;ethane |
|---|---|
| PubChem CID | 90757175 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methoxyimino-2-thiophen-2-ylacetamide;ethane |
| SMILES | CC.CON=C(C(=O)NCCc1ccc(OC)c(OC)c1)c1cccs1 |
| InChI | InChI=1S/C17H20N2O4S.C2H6/c1-21-13-7-6-12(11-14(13)22-2)8-9-18-17(20)16(19-23-3)15-5-4-10-24-15;1-2/h4-7,10-11H,8-9H2,1-3H3,(H,18,20);1-2H3 |
| InChIKey | XEHWFLUNZNLVLJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|