C20H24BrNO3 — CID 4730559
5-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-2,3,4-trimethylbenzamide (PubChem CID 4730559) has the molecular formula C20H24BrNO3 and a molecular weight of 406.32 g/mol. Its IUPAC name is 5-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-2,3,4-trimethylbenzamide.
| Compound Name | 5-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-2,3,4-trimethylbenzamide |
|---|---|
| PubChem CID | 4730559 |
| Molecular Formula | C20H24BrNO3 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 5-bromo-N-[2-(3,4-dimethoxyphenyl)ethyl]-2,3,4-trimethylbenzamide |
| SMILES | COc1ccc(CCNC(=O)c2cc(Br)c(C)c(C)c2C)cc1OC |
| InChI | InChI=1S/C20H24BrNO3/c1-12-13(2)16(11-17(21)14(12)3)20(23)22-9-8-15-6-7-18(24-4)19(10-15)25-5/h6-7,10-11H,8-9H2,1-5H3,(H,22,23) |
| InChIKey | QDRVDYSJTSZASH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |