C17H17ClFNO3 — CID 9083338
5-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-fluorobenzamide (PubChem CID 9083338) has the molecular formula C17H17ClFNO3 and a molecular weight of 337.78 g/mol. Its IUPAC name is 5-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-fluorobenzamide.
| Compound Name | 5-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 9083338 |
| Molecular Formula | C17H17ClFNO3 |
| Molecular Weight | 337.78 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 5-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-fluorobenzamide |
| SMILES | COc1ccc(CCNC(=O)c2cc(Cl)ccc2F)cc1OC |
| InChI | InChI=1S/C17H17ClFNO3/c1-22-15-6-3-11(9-16(15)23-2)7-8-20-17(21)13-10-12(18)4-5-14(13)19/h3-6,9-10H,7-8H2,1-2H3,(H,20,21) |
| InChIKey | DGPAUKZCIUIOIZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.78 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |