C22H27FN2O5S — CID 3337199
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-fluoro-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 3337199) has the molecular formula C22H27FN2O5S and a molecular weight of 450.53 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-fluoro-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-fluoro-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 3337199 |
| Molecular Formula | C22H27FN2O5S |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-fluoro-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(CCNC(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2F)cc1OC |
| InChI | InChI=1S/C22H27FN2O5S/c1-29-20-9-6-16(14-21(20)30-2)10-11-24-22(26)18-15-17(7-8-19(18)23)31(27,28)25-12-4-3-5-13-25/h6-9,14-15H,3-5,10-13H2,1-2H3,(H,24,26) |
| InChIKey | OSWXVUFKRZZYSW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |