C21H25FN2O6S — CID 3560058
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-fluoro-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 3560058) has the molecular formula C21H25FN2O6S and a molecular weight of 452.50 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-fluoro-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-fluoro-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 3560058 |
| Molecular Formula | C21H25FN2O6S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-fluoro-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(CCNC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2F)cc1OC |
| InChI | InChI=1S/C21H25FN2O6S/c1-28-19-6-3-15(13-20(19)29-2)7-8-23-21(25)17-14-16(4-5-18(17)22)31(26,27)24-9-11-30-12-10-24/h3-6,13-14H,7-12H2,1-2H3,(H,23,25) |
| InChIKey | JRGXMZGVMIYZPZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |