C23H29FN2O5S — CID 55796989
N-[2-(4-butoxyphenyl)ethyl]-2-fluoro-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 55796989) has the molecular formula C23H29FN2O5S and a molecular weight of 464.56 g/mol. Its IUPAC name is N-[2-(4-butoxyphenyl)ethyl]-2-fluoro-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[2-(4-butoxyphenyl)ethyl]-2-fluoro-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55796989 |
| Molecular Formula | C23H29FN2O5S |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-[2-(4-butoxyphenyl)ethyl]-2-fluoro-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCCCOc1ccc(CCNC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2F)cc1 |
| InChI | InChI=1S/C23H29FN2O5S/c1-2-3-14-31-19-6-4-18(5-7-19)10-11-25-23(27)21-17-20(8-9-22(21)24)32(28,29)26-12-15-30-16-13-26/h4-9,17H,2-3,10-16H2,1H3,(H,25,27) |
| InChIKey | XBSIJIJYRPLXOL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|