C19H23FN2O6S — CID 55478702
2-fluoro-N-[3-(furan-2-ylmethoxy)propyl]-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 55478702) has the molecular formula C19H23FN2O6S and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-fluoro-N-[3-(furan-2-ylmethoxy)propyl]-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-fluoro-N-[3-(furan-2-ylmethoxy)propyl]-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55478702 |
| Molecular Formula | C19H23FN2O6S |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-fluoro-N-[3-(furan-2-ylmethoxy)propyl]-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NCCCOCc1ccco1)c1cc(S(=O)(=O)N2CCOCC2)ccc1F |
| InChI | InChI=1S/C19H23FN2O6S/c20-18-5-4-16(29(24,25)22-7-11-26-12-8-22)13-17(18)19(23)21-6-2-9-27-14-15-3-1-10-28-15/h1,3-5,10,13H,2,6-9,11-12,14H2,(H,21,23) |
| InChIKey | WQFJCOLEJCCVDG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|