C19H30N2O5S — CID 8928626
2-methyl-N-[3-(2-methylpropoxy)propyl]-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 8928626) has the molecular formula C19H30N2O5S and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-methyl-N-[3-(2-methylpropoxy)propyl]-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-methyl-N-[3-(2-methylpropoxy)propyl]-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 8928626 |
| Molecular Formula | C19H30N2O5S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-methyl-N-[3-(2-methylpropoxy)propyl]-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)NCCCOCC(C)C |
| InChI | InChI=1S/C19H30N2O5S/c1-15(2)14-26-10-4-7-20-19(22)18-13-17(6-5-16(18)3)27(23,24)21-8-11-25-12-9-21/h5-6,13,15H,4,7-12,14H2,1-3H3,(H,20,22) |
| InChIKey | ZAWUSBSOEUJJEW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|