C20H24F2N2O5S — CID 55463061
1-(3,4-difluorophenyl)sulfonyl-N-[3-(furan-2-ylmethoxy)propyl]piperidine-4-carboxamide (PubChem CID 55463061) has the molecular formula C20H24F2N2O5S and a molecular weight of 442.48 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfonyl-N-[3-(furan-2-ylmethoxy)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(3,4-difluorophenyl)sulfonyl-N-[3-(furan-2-ylmethoxy)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55463061 |
| Molecular Formula | C20H24F2N2O5S |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfonyl-N-[3-(furan-2-ylmethoxy)propyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCCOCc1ccco1)C1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C20H24F2N2O5S/c21-18-5-4-17(13-19(18)22)30(26,27)24-9-6-15(7-10-24)20(25)23-8-2-11-28-14-16-3-1-12-29-16/h1,3-5,12-13,15H,2,6-11,14H2,(H,23,25) |
| InChIKey | LBFXQSMZACOPAX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|