C16H22F2N2O3S — CID 51159101
1-(3,4-difluorophenyl)sulfonyl-N-(2-methylpropyl)piperidine-4-carboxamide (PubChem CID 51159101) has the molecular formula C16H22F2N2O3S and a molecular weight of 360.43 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfonyl-N-(2-methylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-(3,4-difluorophenyl)sulfonyl-N-(2-methylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51159101 |
| Molecular Formula | C16H22F2N2O3S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfonyl-N-(2-methylpropyl)piperidine-4-carboxamide |
| SMILES | CC(C)CNC(=O)C1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H22F2N2O3S/c1-11(2)10-19-16(21)12-5-7-20(8-6-12)24(22,23)13-3-4-14(17)15(18)9-13/h3-4,9,11-12H,5-8,10H2,1-2H3,(H,19,21) |
| InChIKey | POFNHUIWEIPBJK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |