C21H23F3N2O3S2 — CID 26635658
1-(3,4-difluorophenyl)sulfonyl-N-[3-(4-fluorophenyl)sulfanylpropyl]piperidine-4-carboxamide (PubChem CID 26635658) has the molecular formula C21H23F3N2O3S2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfonyl-N-[3-(4-fluorophenyl)sulfanylpropyl]piperidine-4-carboxamide.
| Compound Name | 1-(3,4-difluorophenyl)sulfonyl-N-[3-(4-fluorophenyl)sulfanylpropyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26635658 |
| Molecular Formula | C21H23F3N2O3S2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfonyl-N-[3-(4-fluorophenyl)sulfanylpropyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCCSc1ccc(F)cc1)C1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C21H23F3N2O3S2/c22-16-2-4-17(5-3-16)30-13-1-10-25-21(27)15-8-11-26(12-9-15)31(28,29)18-6-7-19(23)20(24)14-18/h2-7,14-15H,1,8-13H2,(H,25,27) |
| InChIKey | UFYCOYMZRXSZHN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|