C23H27FN2O3S2 — CID 27802420
N-[3-(4-fluorophenyl)sulfanylpropyl]-1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 27802420) has the molecular formula C23H27FN2O3S2 and a molecular weight of 462.61 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)sulfanylpropyl]-1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-(4-fluorophenyl)sulfanylpropyl]-1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 27802420 |
| Molecular Formula | C23H27FN2O3S2 |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-[3-(4-fluorophenyl)sulfanylpropyl]-1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCCCSc1ccc(F)cc1)C1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C23H27FN2O3S2/c24-21-7-9-22(10-8-21)30-17-4-14-25-23(27)20-11-15-26(16-12-20)31(28,29)18-13-19-5-2-1-3-6-19/h1-3,5-10,13,18,20H,4,11-12,14-17H2,(H,25,27)/b18-13+ |
| InChIKey | ZNQCNGUEFUHUFI-QGOAFFKASA-N |
| XLogP | 4.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|