C20H20F2N2O3S — CID 76859981
N-(2,6-difluorophenyl)-1-(2-phenylethenylsulfonyl)piperidine-4-carboxamide (PubChem CID 76859981) has the molecular formula C20H20F2N2O3S and a molecular weight of 406.45 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-1-(2-phenylethenylsulfonyl)piperidine-4-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-1-(2-phenylethenylsulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 76859981 |
| Molecular Formula | C20H20F2N2O3S |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-(2,6-difluorophenyl)-1-(2-phenylethenylsulfonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)C1CCN(S(=O)(=O)C=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H20F2N2O3S/c21-17-7-4-8-18(22)19(17)23-20(25)16-9-12-24(13-10-16)28(26,27)14-11-15-5-2-1-3-6-15/h1-8,11,14,16H,9-10,12-13H2,(H,23,25) |
| InChIKey | ROXDBNHWXSAJIB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |