C21H21F3N2O3S — CID 26087824
1-[(E)-2-phenylethenyl]sulfonyl-N-[3-(trifluoromethyl)phenyl]piperidine-4-carboxamide (PubChem CID 26087824) has the molecular formula C21H21F3N2O3S and a molecular weight of 438.47 g/mol. Its IUPAC name is 1-[(E)-2-phenylethenyl]sulfonyl-N-[3-(trifluoromethyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[(E)-2-phenylethenyl]sulfonyl-N-[3-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26087824 |
| Molecular Formula | C21H21F3N2O3S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 1-[(E)-2-phenylethenyl]sulfonyl-N-[3-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C21H21F3N2O3S/c22-21(23,24)18-7-4-8-19(15-18)25-20(27)17-9-12-26(13-10-17)30(28,29)14-11-16-5-2-1-3-6-16/h1-8,11,14-15,17H,9-10,12-13H2,(H,25,27)/b14-11+ |
| InChIKey | YHVQMOZLIPGWLJ-SDNWHVSQSA-N |
| XLogP | 4.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |