C18H18N2O3S — CID 35540858
N-[3-[[(E)-2-phenylethenyl]sulfonylamino]phenyl]cyclopropanecarboxamide (PubChem CID 35540858) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-[3-[[(E)-2-phenylethenyl]sulfonylamino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[[(E)-2-phenylethenyl]sulfonylamino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 35540858 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-[3-[[(E)-2-phenylethenyl]sulfonylamino]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1cccc(NS(=O)(=O)/C=C/c2ccccc2)c1)C1CC1 |
| InChI | InChI=1S/C18H18N2O3S/c21-18(15-9-10-15)19-16-7-4-8-17(13-16)20-24(22,23)12-11-14-5-2-1-3-6-14/h1-8,11-13,15,20H,9-10H2,(H,19,21)/b12-11+ |
| InChIKey | NQERAWHYVAUMSL-VAWYXSNFSA-N |
| XLogP | 3.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |