C16H14Cl2N2O3S — CID 35541069
N-[3-[(3,5-dichlorophenyl)sulfonylamino]phenyl]cyclopropanecarboxamide (PubChem CID 35541069) has the molecular formula C16H14Cl2N2O3S and a molecular weight of 385.27 g/mol. Its IUPAC name is N-[3-[(3,5-dichlorophenyl)sulfonylamino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[(3,5-dichlorophenyl)sulfonylamino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 35541069 |
| Molecular Formula | C16H14Cl2N2O3S |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | N-[3-[(3,5-dichlorophenyl)sulfonylamino]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1cccc(NS(=O)(=O)c2cc(Cl)cc(Cl)c2)c1)C1CC1 |
| InChI | InChI=1S/C16H14Cl2N2O3S/c17-11-6-12(18)8-15(7-11)24(22,23)20-14-3-1-2-13(9-14)19-16(21)10-4-5-10/h1-3,6-10,20H,4-5H2,(H,19,21) |
| InChIKey | IDMNUEXOUZIDBP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |