C15H15N3O5S — CID 51106119
4-[[3-(cyclopropanecarbonylamino)phenyl]sulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 51106119) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is 4-[[3-(cyclopropanecarbonylamino)phenyl]sulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[[3-(cyclopropanecarbonylamino)phenyl]sulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 51106119 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 4-[[3-(cyclopropanecarbonylamino)phenyl]sulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2cccc(NC(=O)C3CC3)c2)c[nH]1 |
| InChI | InChI=1S/C15H15N3O5S/c19-14(9-4-5-9)17-10-2-1-3-11(6-10)18-24(22,23)12-7-13(15(20)21)16-8-12/h1-3,6-9,16,18H,4-5H2,(H,17,19)(H,20,21) |
| InChIKey | ILTOPVIHVYHFRB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |