C21H22N4O5S — CID 56580607
N-[3-(benzenesulfonamido)phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 56580607) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-[3-(benzenesulfonamido)phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-[3-(benzenesulfonamido)phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 56580607 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-[3-(benzenesulfonamido)phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | O=C1NC(=O)C2(CCC(C(=O)Nc3cccc(NS(=O)(=O)c4ccccc4)c3)CC2)N1 |
| InChI | InChI=1S/C21H22N4O5S/c26-18(14-9-11-21(12-10-14)19(27)23-20(28)24-21)22-15-5-4-6-16(13-15)25-31(29,30)17-7-2-1-3-8-17/h1-8,13-14,25H,9-12H2,(H,22,26)(H2,23,24,27,28) |
| InChIKey | MCMBYJJGYQWLSS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|