C22H20N4O3S — CID 56581473
N-[3-(1,3-benzothiazol-2-yl)phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 56581473) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 56581473 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | O=C1NC(=O)C2(CCC(C(=O)Nc3cccc(-c4nc5ccccc5s4)c3)CC2)N1 |
| InChI | InChI=1S/C22H20N4O3S/c27-18(13-8-10-22(11-9-13)20(28)25-21(29)26-22)23-15-5-3-4-14(12-15)19-24-16-6-1-2-7-17(16)30-19/h1-7,12-13H,8-11H2,(H,23,27)(H2,25,26,28,29) |
| InChIKey | RZGGZYLXJHLHCM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|