C20H9F5N2OS — CID 5067994
N-[3-(1,3-benzothiazol-2-yl)phenyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 5067994) has the molecular formula C20H9F5N2OS and a molecular weight of 420.36 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 5067994 |
| Molecular Formula | C20H9F5N2OS |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(Nc1cccc(-c2nc3ccccc3s2)c1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H9F5N2OS/c21-14-13(15(22)17(24)18(25)16(14)23)19(28)26-10-5-3-4-9(8-10)20-27-11-6-1-2-7-12(11)29-20/h1-8H,(H,26,28) |
| InChIKey | RODPQCHTCPZVSX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|