C23H20N2OS2 — CID 41147462
N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-propan-2-ylsulfanylbenzamide (PubChem CID 41147462) has the molecular formula C23H20N2OS2 and a molecular weight of 404.56 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-propan-2-ylsulfanylbenzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-propan-2-ylsulfanylbenzamide |
|---|---|
| PubChem CID | 41147462 |
| Molecular Formula | C23H20N2OS2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-propan-2-ylsulfanylbenzamide |
| SMILES | CC(C)Sc1ccc(C(=O)Nc2cccc(-c3nc4ccccc4s3)c2)cc1 |
| InChI | InChI=1S/C23H20N2OS2/c1-15(2)27-19-12-10-16(11-13-19)22(26)24-18-7-5-6-17(14-18)23-25-20-8-3-4-9-21(20)28-23/h3-15H,1-2H3,(H,24,26) |
| InChIKey | UNKKYJNIHUZNJU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |