C24H21N3OS2 — CID 2902322
N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-4-propan-2-ylbenzamide (PubChem CID 2902322) has the molecular formula C24H21N3OS2 and a molecular weight of 431.59 g/mol. Its IUPAC name is N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 2902322 |
| Molecular Formula | C24H21N3OS2 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-4-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(C(=O)NC(=S)Nc2cccc(-c3nc4ccccc4s3)c2)cc1 |
| InChI | InChI=1S/C24H21N3OS2/c1-15(2)16-10-12-17(13-11-16)22(28)27-24(29)25-19-7-5-6-18(14-19)23-26-20-8-3-4-9-21(20)30-23/h3-15H,1-2H3,(H2,25,27,28,29) |
| InChIKey | DSSCVXDUCKWBMF-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|