C25H23N3O2S2 — CID 17104261
N-[[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-4-propan-2-yloxybenzamide (PubChem CID 17104261) has the molecular formula C25H23N3O2S2 and a molecular weight of 461.61 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-4-propan-2-yloxybenzamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 17104261 |
| Molecular Formula | C25H23N3O2S2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-4-propan-2-yloxybenzamide |
| SMILES | Cc1cc(-c2nc3ccccc3s2)ccc1NC(=S)NC(=O)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C25H23N3O2S2/c1-15(2)30-19-11-8-17(9-12-19)23(29)28-25(31)27-20-13-10-18(14-16(20)3)24-26-21-6-4-5-7-22(21)32-24/h4-15H,1-3H3,(H2,27,28,29,31) |
| InChIKey | WEBXLOABRFOEED-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|