C24H20N4O4S2 — CID 17114760
N-[[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-4-ethoxy-3-nitrobenzamide (PubChem CID 17114760) has the molecular formula C24H20N4O4S2 and a molecular weight of 492.58 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-4-ethoxy-3-nitrobenzamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-4-ethoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 17114760 |
| Molecular Formula | C24H20N4O4S2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-4-ethoxy-3-nitrobenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccc(-c3nc4ccccc4s3)cc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H20N4O4S2/c1-3-32-20-11-9-15(13-19(20)28(30)31)22(29)27-24(33)26-17-10-8-16(12-14(17)2)23-25-18-6-4-5-7-21(18)34-23/h4-13H,3H2,1-2H3,(H2,26,27,29,33) |
| InChIKey | PUEVYHQKQXFOCR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|