C19H17N5O5S2 — CID 3290714
N-[(6-acetamido-1,3-benzothiazol-2-yl)carbamothioyl]-4-ethoxy-3-nitrobenzamide (PubChem CID 3290714) has the molecular formula C19H17N5O5S2 and a molecular weight of 459.51 g/mol. Its IUPAC name is N-[(6-acetamido-1,3-benzothiazol-2-yl)carbamothioyl]-4-ethoxy-3-nitrobenzamide.
| Compound Name | N-[(6-acetamido-1,3-benzothiazol-2-yl)carbamothioyl]-4-ethoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 3290714 |
| Molecular Formula | C19H17N5O5S2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | N-[(6-acetamido-1,3-benzothiazol-2-yl)carbamothioyl]-4-ethoxy-3-nitrobenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2nc3ccc(NC(C)=O)cc3s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17N5O5S2/c1-3-29-15-7-4-11(8-14(15)24(27)28)17(26)22-18(30)23-19-21-13-6-5-12(20-10(2)25)9-16(13)31-19/h4-9H,3H2,1-2H3,(H,20,25)(H2,21,22,23,26,30) |
| InChIKey | CWAYEBGQQXLTHU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|