C17H14N4O5S — CID 5239584
N-(6-acetamido-1,3-benzothiazol-2-yl)-4-methoxy-3-nitrobenzamide (PubChem CID 5239584) has the molecular formula C17H14N4O5S and a molecular weight of 386.39 g/mol. Its IUPAC name is N-(6-acetamido-1,3-benzothiazol-2-yl)-4-methoxy-3-nitrobenzamide.
| Compound Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 5239584 |
| Molecular Formula | C17H14N4O5S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)Nc2nc3ccc(NC(C)=O)cc3s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N4O5S/c1-9(22)18-11-4-5-12-15(8-11)27-17(19-12)20-16(23)10-3-6-14(26-2)13(7-10)21(24)25/h3-8H,1-2H3,(H,18,22)(H,19,20,23) |
| InChIKey | JLZLPEINVGJEAW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|