C25H23N3O6S — CID 17273906
N-[2-[(3,4-dimethoxybenzoyl)amino]-1,3-benzothiazol-6-yl]-3,4-dimethoxybenzamide (PubChem CID 17273906) has the molecular formula C25H23N3O6S and a molecular weight of 493.54 g/mol. Its IUPAC name is N-[2-[(3,4-dimethoxybenzoyl)amino]-1,3-benzothiazol-6-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[(3,4-dimethoxybenzoyl)amino]-1,3-benzothiazol-6-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17273906 |
| Molecular Formula | C25H23N3O6S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | N-[2-[(3,4-dimethoxybenzoyl)amino]-1,3-benzothiazol-6-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3nc(NC(=O)c4ccc(OC)c(OC)c4)sc3c2)cc1OC |
| InChI | InChI=1S/C25H23N3O6S/c1-31-18-9-5-14(11-20(18)33-3)23(29)26-16-7-8-17-22(13-16)35-25(27-17)28-24(30)15-6-10-19(32-2)21(12-15)34-4/h5-13H,1-4H3,(H,26,29)(H,27,28,30) |
| InChIKey | JCAFCSRSFUYHHC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |