C16H15N3O3S — CID 141297595
2-amino-N-(3,4-dimethoxyphenyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 141297595) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-amino-N-(3,4-dimethoxyphenyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N-(3,4-dimethoxyphenyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 141297595 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-amino-N-(3,4-dimethoxyphenyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3nc(N)sc3c2)cc1OC |
| InChI | InChI=1S/C16H15N3O3S/c1-21-12-6-4-10(8-13(12)22-2)18-15(20)9-3-5-11-14(7-9)23-16(17)19-11/h3-8H,1-2H3,(H2,17,19)(H,18,20) |
| InChIKey | HOCCNNNKJAAKAN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |