C14H10FN3OS — CID 60636089
2-amino-N-(4-fluorophenyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 60636089) has the molecular formula C14H10FN3OS and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-amino-N-(4-fluorophenyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N-(4-fluorophenyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 60636089 |
| Molecular Formula | C14H10FN3OS |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-amino-N-(4-fluorophenyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | Nc1nc2ccc(C(=O)Nc3ccc(F)cc3)cc2s1 |
| InChI | InChI=1S/C14H10FN3OS/c15-9-2-4-10(5-3-9)17-13(19)8-1-6-11-12(7-8)20-14(16)18-11/h1-7H,(H2,16,18)(H,17,19) |
| InChIKey | IGJWWDFEQGQSAB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |