C14H10N4O3S — CID 110451284
2-amino-N-(4-nitrophenyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 110451284) has the molecular formula C14H10N4O3S and a molecular weight of 314.33 g/mol. Its IUPAC name is 2-amino-N-(4-nitrophenyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N-(4-nitrophenyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 110451284 |
| Molecular Formula | C14H10N4O3S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-amino-N-(4-nitrophenyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | Nc1nc2ccc(C(=O)Nc3ccc([N+](=O)[O-])cc3)cc2s1 |
| InChI | InChI=1S/C14H10N4O3S/c15-14-17-11-6-1-8(7-12(11)22-14)13(19)16-9-2-4-10(5-3-9)18(20)21/h1-7H,(H2,15,17)(H,16,19) |
| InChIKey | NMXQMLXGGHMRTJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|