C14H12N4O3S2 — CID 110451808
2-amino-N-(4-sulfamoylphenyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 110451808) has the molecular formula C14H12N4O3S2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-amino-N-(4-sulfamoylphenyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N-(4-sulfamoylphenyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 110451808 |
| Molecular Formula | C14H12N4O3S2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-amino-N-(4-sulfamoylphenyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | Nc1nc2ccc(C(=O)Nc3ccc(S(N)(=O)=O)cc3)cc2s1 |
| InChI | InChI=1S/C14H12N4O3S2/c15-14-18-11-6-1-8(7-12(11)22-14)13(19)17-9-2-4-10(5-3-9)23(16,20)21/h1-7H,(H2,15,18)(H,17,19)(H2,16,20,21) |
| InChIKey | ZNLFRIZRCZIYJL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |