C9H8N4O2S — CID 79195134
2-amino-N-carbamoyl-1,3-benzothiazole-6-carboxamide (PubChem CID 79195134) has the molecular formula C9H8N4O2S and a molecular weight of 236.26 g/mol. Its IUPAC name is 2-amino-N-carbamoyl-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N-carbamoyl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 79195134 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-amino-N-carbamoyl-1,3-benzothiazole-6-carboxamide |
| SMILES | NC(=O)NC(=O)c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C9H8N4O2S/c10-8(15)13-7(14)4-1-2-5-6(3-4)16-9(11)12-5/h1-3H,(H2,11,12)(H3,10,13,14,15) |
| InChIKey | AEEMYQMTPCRBAM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |