C12H14N4O2S — CID 60636547
N-(2-acetamidoethyl)-2-amino-1,3-benzothiazole-6-carboxamide (PubChem CID 60636547) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-amino-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-2-amino-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 60636547 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | N-(2-acetamidoethyl)-2-amino-1,3-benzothiazole-6-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C12H14N4O2S/c1-7(17)14-4-5-15-11(18)8-2-3-9-10(6-8)19-12(13)16-9/h2-3,6H,4-5H2,1H3,(H2,13,16)(H,14,17)(H,15,18) |
| InChIKey | NGSKEHKKGHZSCU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|