C13H17N3O2S2 — CID 106310864
2-amino-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 106310864) has the molecular formula C13H17N3O2S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-amino-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 106310864 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-amino-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | Nc1nc2ccc(C(=O)NCCSCCCO)cc2s1 |
| InChI | InChI=1S/C13H17N3O2S2/c14-13-16-10-3-2-9(8-11(10)20-13)12(18)15-4-7-19-6-1-5-17/h2-3,8,17H,1,4-7H2,(H2,14,16)(H,15,18) |
| InChIKey | KAQRIRRAFRXSRW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|