C9H9N5OS — CID 15290270
2-amino-N-(diaminomethylidene)-1,3-benzothiazole-6-carboxamide (PubChem CID 15290270) has the molecular formula C9H9N5OS and a molecular weight of 235.27 g/mol. Its IUPAC name is 2-amino-N-(diaminomethylidene)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N-(diaminomethylidene)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 15290270 |
| Molecular Formula | C9H9N5OS |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-amino-N-(diaminomethylidene)-1,3-benzothiazole-6-carboxamide |
| SMILES | NC(N)=NC(=O)c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C9H9N5OS/c10-8(11)14-7(15)4-1-2-5-6(3-4)16-9(12)13-5/h1-3H,(H2,12,13)(H4,10,11,14,15) |
| InChIKey | LHJLOLDWEBACJF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|